C20H30O4 — CID 90972001
(1'R,4'bS,10'aR)-1'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,10-hexahydro-1H-phenanthrene]-9'-one (PubChem CID 90972001) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1'R,4'bS,10'aR)-1'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,10-hexahydro-1H-phenanthrene]-9'-one.
| Compound Name | (1'R,4'bS,10'aR)-1'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,10-hexahydro-1H-phenanthrene]-9'-one |
|---|---|
| PubChem CID | 90972001 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1'R,4'bS,10'aR)-1'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-2,3,5,6,8a,10-hexahydro-1H-phenanthrene]-9'-one |
| SMILES | CC1(C)C2C(=O)C[C@]3(C)C(=CCC[C@H]3O)[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C20H30O4/c1-17(2)16-13(21)12-19(4)14(6-5-7-15(19)22)18(16,3)8-9-20(17)23-10-11-24-20/h6,15-16,22H,5,7-12H2,1-4H3/t15-,16?,18-,19-/m1/s1 |
| InChIKey | ALJOUADXXUFRJJ-DSSQQLCSSA-N |
| XLogP | 3.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|