C13H19NO — CID 90972018
1-(furan-3-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 90972018) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(furan-3-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 90972018 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(furan-3-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | c1cc(CN2CCC3CCCCC32)co1 |
| InChI | InChI=1S/C13H19NO/c1-2-4-13-12(3-1)5-7-14(13)9-11-6-8-15-10-11/h6,8,10,12-13H,1-5,7,9H2 |
| InChIKey | DKTRWJMLQWYEIG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |