About triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane
triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane (PubChem CID 90972349) has the molecular formula C18H30INOSSi
and a molecular weight of 463.50 g/mol. Its IUPAC name is triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane |
| PubChem CID | 90972349 |
| Molecular Formula | C18H30INOSSi |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](CC=C(C)I)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C18H30INOSSi/c1-7-23(8-2,9-3)21-18(11-10-15(5)19)14(4)12-17-13-22-16(6)20-17/h10,12-13,18H,7-9,11H2,1-6H3/t18-/m0/s1 |
| InChIKey | BACDJKIPHQDIMD-SFHVURJKSA-N |
| XLogP | 6.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane?
The IUPAC name of triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane (CID 90972349) is triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane.
What is the SMILES notation for triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane?
The canonical SMILES for triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane is CC[Si](CC)(CC)O[C@@H](CC=C(C)I)C(C)=Cc1csc(C)n1.
What is the InChIKey of triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane?
The InChIKey is BACDJKIPHQDIMD-SFHVURJKSA-N. The full InChI is InChI=1S/C18H30INOSSi/c1-7-23(8-2,9-3)21-18(11-10-15(5)19)14(4)12-17-13-22-16(6)20-17/h10,12-13,18H,7-9,11H2,1-6H3/t18-/m0/s1.
What are the key properties of triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane?
triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane has a molecular weight of 463.50 g/mol, XLogP of 6.97, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(3S)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxysilane is sourced from PubChem (CID 90972349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).