C23H18BrFN4O — CID 90972995
N-[2-bromo-5-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]quinazolin-4-amine (PubChem CID 90972995) has the molecular formula C23H18BrFN4O and a molecular weight of 465.33 g/mol. Its IUPAC name is N-[2-bromo-5-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]quinazolin-4-amine.
| Compound Name | N-[2-bromo-5-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 90972995 |
| Molecular Formula | C23H18BrFN4O |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[2-bromo-5-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]quinazolin-4-amine |
| SMILES | C=C(NOCc1ccc(F)cc1)c1ccc(Br)c(Nc2ncnc3ccccc23)c1 |
| InChI | InChI=1S/C23H18BrFN4O/c1-15(29-30-13-16-6-9-18(25)10-7-16)17-8-11-20(24)22(12-17)28-23-19-4-2-3-5-21(19)26-14-27-23/h2-12,14,29H,1,13H2,(H,26,27,28) |
| InChIKey | GBYYBRFYAGJHDR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|