C25H31F3N2O4Si — CID 90973030
(5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 90973030) has the molecular formula C25H31F3N2O4Si and a molecular weight of 508.61 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90973030 |
| Molecular Formula | C25H31F3N2O4Si |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(C)OC3(C)C[C@H]2CO[Si](C)(C)C(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C25H31F3N2O4Si/c1-22(2,3)35(7,8)33-13-14-12-23(4)18-19(24(14,5)34-23)21(32)30(20(18)31)15-9-10-17(29-6)16(11-15)25(26,27)28/h9-11,14,31-32H,12-13H2,1-5,7-8H3/t14-,23?,24?/m0/s1 |
| InChIKey | OLBXPXVJZUEQFG-SMTYRMSJSA-N |
| XLogP | 6.96 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|