C23H22N4O2S — CID 90973385
(4S)-3-(2,3-dihydro-1-benzofuran-5-yl)-6-imino-1,4-dimethyl-4-(4-pyrimidin-5-ylthiophen-2-yl)piperidin-2-one (PubChem CID 90973385) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is (4S)-3-(2,3-dihydro-1-benzofuran-5-yl)-6-imino-1,4-dimethyl-4-(4-pyrimidin-5-ylthiophen-2-yl)piperidin-2-one.
| Compound Name | (4S)-3-(2,3-dihydro-1-benzofuran-5-yl)-6-imino-1,4-dimethyl-4-(4-pyrimidin-5-ylthiophen-2-yl)piperidin-2-one |
|---|---|
| PubChem CID | 90973385 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (4S)-3-(2,3-dihydro-1-benzofuran-5-yl)-6-imino-1,4-dimethyl-4-(4-pyrimidin-5-ylthiophen-2-yl)piperidin-2-one |
| SMILES | [H]/N=C1/C[C@](C)(c2cc(-c3cncnc3)cs2)C(c2ccc3c(c2)CCO3)C(=O)N1C |
| InChI | InChI=1S/C23H22N4O2S/c1-23(19-8-16(12-30-19)17-10-25-13-26-11-17)9-20(24)27(2)22(28)21(23)15-3-4-18-14(7-15)5-6-29-18/h3-4,7-8,10-13,21,24H,5-6,9H2,1-2H3/b24-20-/t21?,23-/m1/s1 |
| InChIKey | ROWIWYDMUYNCAT-ORQZFJLHSA-N |
| XLogP | 4.02 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|