About ethane;4-hydroxyphthalaldehyde
ethane;4-hydroxyphthalaldehyde (PubChem CID 90973394) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is ethane;4-hydroxyphthalaldehyde.
Molecular Properties
| Compound Name | ethane;4-hydroxyphthalaldehyde |
| PubChem CID | 90973394 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | ethane;4-hydroxyphthalaldehyde |
| SMILES | CC.O=Cc1ccc(O)cc1C=O |
| InChI | InChI=1S/C8H6O3.C2H6/c9-4-6-1-2-8(11)3-7(6)5-10;1-2/h1-5,11H;1-2H3 |
| InChIKey | RXDDIEYBTJDVPL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-hydroxyphthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-hydroxyphthalaldehyde?
The IUPAC name of ethane;4-hydroxyphthalaldehyde (CID 90973394) is ethane;4-hydroxyphthalaldehyde.
What is the SMILES notation for ethane;4-hydroxyphthalaldehyde?
The canonical SMILES for ethane;4-hydroxyphthalaldehyde is CC.O=Cc1ccc(O)cc1C=O.
What is the InChIKey of ethane;4-hydroxyphthalaldehyde?
The InChIKey is RXDDIEYBTJDVPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3.C2H6/c9-4-6-1-2-8(11)3-7(6)5-10;1-2/h1-5,11H;1-2H3.
What are the key properties of ethane;4-hydroxyphthalaldehyde?
ethane;4-hydroxyphthalaldehyde has a molecular weight of 180.20 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-hydroxyphthalaldehyde is sourced from PubChem (CID 90973394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).