C10H19N3 — CID 90973590
1-ethenyl-1-(1,5,6-trimethyl-3,4-dihydro-2H-pyridin-2-yl)hydrazine (PubChem CID 90973590) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-ethenyl-1-(1,5,6-trimethyl-3,4-dihydro-2H-pyridin-2-yl)hydrazine.
| Compound Name | 1-ethenyl-1-(1,5,6-trimethyl-3,4-dihydro-2H-pyridin-2-yl)hydrazine |
|---|---|
| PubChem CID | 90973590 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-ethenyl-1-(1,5,6-trimethyl-3,4-dihydro-2H-pyridin-2-yl)hydrazine |
| SMILES | C=CN(N)C1CCC(C)=C(C)N1C |
| InChI | InChI=1S/C10H19N3/c1-5-13(11)10-7-6-8(2)9(3)12(10)4/h5,10H,1,6-7,11H2,2-4H3 |
| InChIKey | KIEBLBZOIDFYEQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|