About 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate
2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate (PubChem CID 90973936) has the molecular formula C22H21N3O6S
and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate.
Molecular Properties
| Compound Name | 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate |
| PubChem CID | 90973936 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate |
| SMILES | Cc1cc(S(=O)(=O)CCOC=O)cc2c(Nc3cccc4c3CCO4)c(C(N)=O)cnc12 |
| InChI | InChI=1S/C22H21N3O6S/c1-13-9-14(32(28,29)8-7-30-12-26)10-16-20(13)24-11-17(22(23)27)21(16)25-18-3-2-4-19-15(18)5-6-31-19/h2-4,9-12H,5-8H2,1H3,(H2,23,27)(H,24,25) |
| InChIKey | KDPCYICVYBNZSW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate?
The IUPAC name of 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate (CID 90973936) is 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate.
What is the SMILES notation for 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate?
The canonical SMILES for 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate is Cc1cc(S(=O)(=O)CCOC=O)cc2c(Nc3cccc4c3CCO4)c(C(N)=O)cnc12.
What is the InChIKey of 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate?
The InChIKey is KDPCYICVYBNZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O6S/c1-13-9-14(32(28,29)8-7-30-12-26)10-16-20(13)24-11-17(22(23)27)21(16)25-18-3-2-4-19-15(18)5-6-31-19/h2-4,9-12H,5-8H2,1H3,(H2,23,27)(H,24,25).
What are the key properties of 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate?
2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate has a molecular weight of 455.49 g/mol, XLogP of 2.27, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-carbamoyl-4-(2,3-dihydro-1-benzofuran-4-ylamino)-8-methylquinolin-6-yl]sulfonylethyl formate is sourced from PubChem (CID 90973936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).