C23H23ClN3O4S- — CID 90973946
4-[3-(2-chlorophenyl)-N-sulfinatoanilino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 90973946) has the molecular formula C23H23ClN3O4S- and a molecular weight of 472.97 g/mol. Its IUPAC name is 4-[3-(2-chlorophenyl)-N-sulfinatoanilino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 4-[3-(2-chlorophenyl)-N-sulfinatoanilino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 90973946 |
| Molecular Formula | C23H23ClN3O4S- |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 4-[3-(2-chlorophenyl)-N-sulfinatoanilino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | CCOC(=O)Cn1ncc2c1CCCC2N(c1cccc(-c2ccccc2Cl)c1)S(=O)[O-] |
| InChI | InChI=1S/C23H24ClN3O4S/c1-2-31-23(28)15-26-21-11-6-12-22(19(21)14-25-26)27(32(29)30)17-8-5-7-16(13-17)18-9-3-4-10-20(18)24/h3-5,7-10,13-14,22H,2,6,11-12,15H2,1H3,(H,29,30)/p-1 |
| InChIKey | NQDJEHVUBCZPHL-UHFFFAOYSA-M |
| XLogP | 4.44 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|