About dodeca-6,10-dien-1-yn-3-ol
dodeca-6,10-dien-1-yn-3-ol (PubChem CID 90973974) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is dodeca-6,10-dien-1-yn-3-ol.
Molecular Properties
| Compound Name | dodeca-6,10-dien-1-yn-3-ol |
| PubChem CID | 90973974 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | dodeca-6,10-dien-1-yn-3-ol |
| SMILES | C#CC(O)CCC=CCCC=CC |
| InChI | InChI=1S/C12H18O/c1-3-5-6-7-8-9-10-11-12(13)4-2/h2-3,5,8-9,12-13H,6-7,10-11H2,1H3 |
| InChIKey | BDKCXRWVPLQOTJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dodeca-6,10-dien-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodeca-6,10-dien-1-yn-3-ol?
The IUPAC name of dodeca-6,10-dien-1-yn-3-ol (CID 90973974) is dodeca-6,10-dien-1-yn-3-ol.
What is the SMILES notation for dodeca-6,10-dien-1-yn-3-ol?
The canonical SMILES for dodeca-6,10-dien-1-yn-3-ol is C#CC(O)CCC=CCCC=CC.
What is the InChIKey of dodeca-6,10-dien-1-yn-3-ol?
The InChIKey is BDKCXRWVPLQOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-3-5-6-7-8-9-10-11-12(13)4-2/h2-3,5,8-9,12-13H,6-7,10-11H2,1H3.
What are the key properties of dodeca-6,10-dien-1-yn-3-ol?
dodeca-6,10-dien-1-yn-3-ol has a molecular weight of 178.27 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodeca-6,10-dien-1-yn-3-ol is sourced from PubChem (CID 90973974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).