C25H40N4O4 — CID 90974092
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-ethyl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide (PubChem CID 90974092) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-ethyl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-ethyl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 90974092 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(1-ethyl-4,5-dihydrotriazol-4-yl)phenyl]ethoxy]propanamide |
| SMILES | CCN1CC(c2cccc(CCOCCC(=O)N(CC(OC)OC)C3CCCCC3)c2)N=N1 |
| InChI | InChI=1S/C25H40N4O4/c1-4-28-18-23(26-27-28)21-10-8-9-20(17-21)13-15-33-16-14-24(30)29(19-25(31-2)32-3)22-11-6-5-7-12-22/h8-10,17,22-23,25H,4-7,11-16,18-19H2,1-3H3 |
| InChIKey | AMRQBNUBVOIASZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|