C23H24FN5O6S3 — CID 90974337
3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-7-[(sulfamoylamino)methyl]-4H-thieno[2,3-e][1,2,4]thiadiazine (PubChem CID 90974337) has the molecular formula C23H24FN5O6S3 and a molecular weight of 581.67 g/mol. Its IUPAC name is 3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-7-[(sulfamoylamino)methyl]-4H-thieno[2,3-e][1,2,4]thiadiazine.
| Compound Name | 3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-7-[(sulfamoylamino)methyl]-4H-thieno[2,3-e][1,2,4]thiadiazine |
|---|---|
| PubChem CID | 90974337 |
| Molecular Formula | C23H24FN5O6S3 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | 3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-7-[(sulfamoylamino)methyl]-4H-thieno[2,3-e][1,2,4]thiadiazine |
| SMILES | NS(=O)(=O)NCc1csc2c1S(=O)(=O)N=C(C1C(=O)C3C([C@@H]4CC[C@H]3C4)N(Cc3ccc(F)cc3)C1=O)N2 |
| InChI | InChI=1S/C23H24FN5O6S3/c24-15-5-1-11(2-6-15)9-29-18-13-4-3-12(7-13)16(18)19(30)17(23(29)31)21-27-22-20(37(32,33)28-21)14(10-36-22)8-26-38(25,34)35/h1-2,5-6,10,12-13,16-18,26H,3-4,7-9H2,(H,27,28)(H2,25,34,35)/t12-,13+,16?,17?,18?/m0/s1 |
| InChIKey | XYRDWMPDTUOXEM-ITYZATEOSA-N |
| XLogP | 1.34 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|