C17H28BrFO10 — CID 90974412
(2R,4R,5S)-5-[(2S,4R,5S)-6-(bromomethyl)-3,4-dihydroxy-5-(oxan-2-yloxy)oxan-2-yl]oxy-2-fluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 90974412) has the molecular formula C17H28BrFO10 and a molecular weight of 491.30 g/mol. Its IUPAC name is (2R,4R,5S)-5-[(2S,4R,5S)-6-(bromomethyl)-3,4-dihydroxy-5-(oxan-2-yloxy)oxan-2-yl]oxy-2-fluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,4R,5S)-5-[(2S,4R,5S)-6-(bromomethyl)-3,4-dihydroxy-5-(oxan-2-yloxy)oxan-2-yl]oxy-2-fluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 90974412 |
| Molecular Formula | C17H28BrFO10 |
| Molecular Weight | 491.30 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (2R,4R,5S)-5-[(2S,4R,5S)-6-(bromomethyl)-3,4-dihydroxy-5-(oxan-2-yloxy)oxan-2-yl]oxy-2-fluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OCC1O[C@H](F)C(O)[C@@H](O)[C@@H]1O[C@H]1OC(CBr)[C@@H](OC2CCCCO2)[C@H](O)C1O |
| InChI | InChI=1S/C17H28BrFO10/c18-5-7-14(28-9-3-1-2-4-25-9)11(22)13(24)17(27-7)29-15-8(6-20)26-16(19)12(23)10(15)21/h7-17,20-24H,1-6H2/t7?,8?,9?,10-,11-,12?,13?,14-,15-,16+,17-/m1/s1 |
| InChIKey | MKHWHTHWMAUEQP-BHVSGGJWSA-N |
| XLogP | -1.47 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.30 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|