C26H32N4O2 — CID 90974913
6-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]-propan-2-ylamino]hexanoic acid (PubChem CID 90974913) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 6-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]-propan-2-ylamino]hexanoic acid.
| Compound Name | 6-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]-propan-2-ylamino]hexanoic acid |
|---|---|
| PubChem CID | 90974913 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 6-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]-propan-2-ylamino]hexanoic acid |
| SMILES | Cc1ccc(-c2nnc(N(CCCCCC(=O)O)C(C)C)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H32N4O2/c1-18(2)30(17-7-5-6-8-23(31)32)26-27-24(21-13-9-19(3)10-14-21)25(28-29-26)22-15-11-20(4)12-16-22/h9-16,18H,5-8,17H2,1-4H3,(H,31,32) |
| InChIKey | GCUUVGKRARDWGD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|