C26H27N3O9 — CID 90975165
(12aS)-9-[(2,5-dihydroxypyrrol-1-yl)methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90975165) has the molecular formula C26H27N3O9 and a molecular weight of 525.51 g/mol. Its IUPAC name is (12aS)-9-[(2,5-dihydroxypyrrol-1-yl)methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (12aS)-9-[(2,5-dihydroxypyrrol-1-yl)methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90975165 |
| Molecular Formula | C26H27N3O9 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | (12aS)-9-[(2,5-dihydroxypyrrol-1-yl)methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(Cn2c(O)ccc2O)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H27N3O9/c1-28(2)14-7-11(9-29-16(31)3-4-17(29)32)21(33)19-13(14)6-10-5-12-8-15(30)20(25(27)37)24(36)26(12,38)23(35)18(10)22(19)34/h3-4,7,10,12,18,20,31-33,38H,5-6,8-9H2,1-2H3,(H2,27,37)/t10?,12?,18?,20?,26-/m0/s1 |
| InChIKey | QDELVEVTKMHYBD-LVHGSFDWSA-N |
| XLogP | -0.35 |
| TPSA | 200.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|