C24H40O10 — CID 90975268
2,3-bis[2-(6-ethoxyhexoxy)-2-oxoethyl]but-2-enedioic acid (PubChem CID 90975268) has the molecular formula C24H40O10 and a molecular weight of 488.57 g/mol. Its IUPAC name is 2,3-bis[2-(6-ethoxyhexoxy)-2-oxoethyl]but-2-enedioic acid.
| Compound Name | 2,3-bis[2-(6-ethoxyhexoxy)-2-oxoethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 90975268 |
| Molecular Formula | C24H40O10 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 2,3-bis[2-(6-ethoxyhexoxy)-2-oxoethyl]but-2-enedioic acid |
| SMILES | CCOCCCCCCOC(=O)CC(C(=O)O)=C(CC(=O)OCCCCCCOCC)C(=O)O |
| InChI | InChI=1S/C24H40O10/c1-3-31-13-9-5-7-11-15-33-21(25)17-19(23(27)28)20(24(29)30)18-22(26)34-16-12-8-6-10-14-32-4-2/h3-18H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | GZZIYZXPWUCAAL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|