C20H25NO5S — CID 90975442
(3R,4R,5S)-2-(dibenzylamino)sulfanyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol (PubChem CID 90975442) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is (3R,4R,5S)-2-(dibenzylamino)sulfanyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol.
| Compound Name | (3R,4R,5S)-2-(dibenzylamino)sulfanyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 90975442 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (3R,4R,5S)-2-(dibenzylamino)sulfanyl-5-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol |
| SMILES | OC[C@@H](O)[C@@H]1OC(SN(Cc2ccccc2)Cc2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25NO5S/c22-13-16(23)19-17(24)18(25)20(26-19)27-21(11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15/h1-10,16-20,22-25H,11-13H2/t16-,17-,18-,19+,20?/m1/s1 |
| InChIKey | KUUXTOPJQJMLAQ-BNCGXOKJSA-N |
| XLogP | 1.14 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|