C15H22FNO2S — CID 90975920
4-(3-fluoro-2-methylsulfonylphenyl)-1-propylpiperidine (PubChem CID 90975920) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is 4-(3-fluoro-2-methylsulfonylphenyl)-1-propylpiperidine.
| Compound Name | 4-(3-fluoro-2-methylsulfonylphenyl)-1-propylpiperidine |
|---|---|
| PubChem CID | 90975920 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-(3-fluoro-2-methylsulfonylphenyl)-1-propylpiperidine |
| SMILES | CCCN1CCC(c2cccc(F)c2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H22FNO2S/c1-3-9-17-10-7-12(8-11-17)13-5-4-6-14(16)15(13)20(2,18)19/h4-6,12H,3,7-11H2,1-2H3 |
| InChIKey | KXXHWCYANOAVGD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |