C17H28N3O2S+ — CID 9097593
2-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylcarbamothioylamino]ethyl-dimethylazanium (PubChem CID 9097593) has the molecular formula C17H28N3O2S+ and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylcarbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylcarbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9097593 |
| Molecular Formula | C17H28N3O2S+ |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-[[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylcarbamothioylamino]ethyl-dimethylazanium |
| SMILES | CCOc1cc2c(cc1CNC(=S)NCC[NH+](C)C)O[C@H](C)C2 |
| InChI | InChI=1S/C17H27N3O2S/c1-5-21-15-9-13-8-12(2)22-16(13)10-14(15)11-19-17(23)18-6-7-20(3)4/h9-10,12H,5-8,11H2,1-4H3,(H2,18,19,23)/p+1/t12-/m1/s1 |
| InChIKey | OCODSLMNNVTYLH-GFCCVEGCSA-O |
| XLogP | 0.52 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|