C23H31ClN3O4+ — CID 90976131
N'-(2-chloro-6-methylphenyl)-1-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperidin-1-ium-1-carbohydrazide (PubChem CID 90976131) has the molecular formula C23H31ClN3O4+ and a molecular weight of 448.97 g/mol. Its IUPAC name is N'-(2-chloro-6-methylphenyl)-1-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperidin-1-ium-1-carbohydrazide.
| Compound Name | N'-(2-chloro-6-methylphenyl)-1-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperidin-1-ium-1-carbohydrazide |
|---|---|
| PubChem CID | 90976131 |
| Molecular Formula | C23H31ClN3O4+ |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N'-(2-chloro-6-methylphenyl)-1-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperidin-1-ium-1-carbohydrazide |
| SMILES | COc1ccccc1OCC(O)C[N+]1(C(=O)NNc2c(C)cccc2Cl)CCCCC1 |
| InChI | InChI=1S/C23H30ClN3O4/c1-17-9-8-10-19(24)22(17)25-26-23(29)27(13-6-3-7-14-27)15-18(28)16-31-21-12-5-4-11-20(21)30-2/h4-5,8-12,18,25,28H,3,6-7,13-16H2,1-2H3/p+1 |
| InChIKey | ADPYYHXXRSMCSD-UHFFFAOYSA-O |
| XLogP | 4.13 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|