C22H28ClNO6 — CID 90976228
4-[3-[amino-(4-ethylphenyl)-hydroxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol (PubChem CID 90976228) has the molecular formula C22H28ClNO6 and a molecular weight of 437.92 g/mol. Its IUPAC name is 4-[3-[amino-(4-ethylphenyl)-hydroxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol.
| Compound Name | 4-[3-[amino-(4-ethylphenyl)-hydroxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 90976228 |
| Molecular Formula | C22H28ClNO6 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-[3-[amino-(4-ethylphenyl)-hydroxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)cyclohexane-1,2,3,5-tetrol |
| SMILES | CCc1ccc(C(N)(O)c2cc(C3C(O)C(O)C(O)C(CO)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H28ClNO6/c1-2-11-3-6-13(7-4-11)22(24,30)15-9-12(5-8-16(15)23)17-18(26)14(10-25)19(27)21(29)20(17)28/h3-9,14,17-21,25-30H,2,10,24H2,1H3 |
| InChIKey | KTKFOJXNJBWGTM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|