C17H18N2O6S — CID 90976262
benzyl 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-4-sulfanylidenepyrimidine-5-carboxylate (PubChem CID 90976262) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is benzyl 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-4-sulfanylidenepyrimidine-5-carboxylate.
| Compound Name | benzyl 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-4-sulfanylidenepyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90976262 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | benzyl 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-4-sulfanylidenepyrimidine-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C17H18N2O6S/c20-8-13-12(21)6-14(25-13)19-7-11(15(26)18-17(19)23)16(22)24-9-10-4-2-1-3-5-10/h1-5,7,12-14,20-21H,6,8-9H2,(H,18,23,26)/t12-,13+,14+/m0/s1 |
| InChIKey | GXWLVRDCDVMOIS-BFHYXJOUSA-N |
| XLogP | 0.90 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|