About 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine
3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine (PubChem CID 90976310) has the molecular formula C22H16N4S
and a molecular weight of 368.47 g/mol. Its IUPAC name is 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine.
Molecular Properties
| Compound Name | 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine |
| PubChem CID | 90976310 |
| Molecular Formula | C22H16N4S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine |
| SMILES | CC1=Nc2ccc(-c3ccc4nccc(-c5ccncc5)c4c3)cc2SN1 |
| InChI | InChI=1S/C22H16N4S/c1-14-25-21-5-3-17(13-22(21)27-26-14)16-2-4-20-19(12-16)18(8-11-24-20)15-6-9-23-10-7-15/h2-13H,1H3,(H,25,26) |
| InChIKey | UGZFVPYJHWGXHZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine?
The IUPAC name of 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine (CID 90976310) is 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine.
What is the SMILES notation for 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine?
The canonical SMILES for 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine is CC1=Nc2ccc(-c3ccc4nccc(-c5ccncc5)c4c3)cc2SN1.
What is the InChIKey of 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine?
The InChIKey is UGZFVPYJHWGXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4S/c1-14-25-21-5-3-17(13-22(21)27-26-14)16-2-4-20-19(12-16)18(8-11-24-20)15-6-9-23-10-7-15/h2-13H,1H3,(H,25,26).
What are the key properties of 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine?
3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine has a molecular weight of 368.47 g/mol, XLogP of 5.62, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-(4-pyridin-4-ylquinolin-6-yl)-2H-1,2,4-benzothiadiazine is sourced from PubChem (CID 90976310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).