C44H34N4O4 — CID 90976358
3-[10,15,20-tris(3-hydroxyphenyl)-2,3,21,22,23,24-hexahydroporphyrin-5-yl]phenol (PubChem CID 90976358) has the molecular formula C44H34N4O4 and a molecular weight of 682.78 g/mol. Its IUPAC name is 3-[10,15,20-tris(3-hydroxyphenyl)-2,3,21,22,23,24-hexahydroporphyrin-5-yl]phenol.
| Compound Name | 3-[10,15,20-tris(3-hydroxyphenyl)-2,3,21,22,23,24-hexahydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 90976358 |
| Molecular Formula | C44H34N4O4 |
| Molecular Weight | 682.78 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | 3-[10,15,20-tris(3-hydroxyphenyl)-2,3,21,22,23,24-hexahydroporphyrin-5-yl]phenol |
| SMILES | Oc1cccc(C2=C3CCC(=C(c4cccc(O)c4)c4ccc([nH]4)C(c4cccc(O)c4)=c4ccc([nH]4)=C(c4cccc(O)c4)c4ccc2[nH]4)N3)c1 |
| InChI | InChI=1S/C44H34N4O4/c49-29-9-1-5-25(21-29)41-33-13-15-35(45-33)42(26-6-2-10-30(50)22-26)37-17-19-39(47-37)44(28-8-4-12-32(52)24-28)40-20-18-38(48-40)43(36-16-14-34(41)46-36)27-7-3-11-31(51)23-27/h1-17,19,21-24,45-52H,18,20H2 |
| InChIKey | WALXSOLEZAQBBL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.78 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |