C17H20BrFN2O4 — CID 90976526
3-(5-bromo-4-fluoro-2-methylphenyl)-1,8-dimethoxy-1,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 90976526) has the molecular formula C17H20BrFN2O4 and a molecular weight of 415.26 g/mol. Its IUPAC name is 3-(5-bromo-4-fluoro-2-methylphenyl)-1,8-dimethoxy-1,8-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(5-bromo-4-fluoro-2-methylphenyl)-1,8-dimethoxy-1,8-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 90976526 |
| Molecular Formula | C17H20BrFN2O4 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 3-(5-bromo-4-fluoro-2-methylphenyl)-1,8-dimethoxy-1,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CON1CCC2(CC1)C(=O)C(c1cc(Br)c(F)cc1C)C(=O)N2OC |
| InChI | InChI=1S/C17H20BrFN2O4/c1-10-8-13(19)12(18)9-11(10)14-15(22)17(21(25-3)16(14)23)4-6-20(24-2)7-5-17/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | PPCWEPWTQNPQKP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|