C68H40F16N8+4 — CID 90976602
5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(1-methylpyridin-1-ium-2-yl)phenyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 90976602) has the molecular formula C68H40F16N8+4 and a molecular weight of 1273.09 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(1-methylpyridin-1-ium-2-yl)phenyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(1-methylpyridin-1-ium-2-yl)phenyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90976602 |
| Molecular Formula | C68H40F16N8+4 |
| Molecular Weight | 1273.09 g/mol |
| Exact Mass | 1272.31 |
| IUPAC Name | 5,10,15,20-tetrakis[2,3,5,6-tetrafluoro-4-(1-methylpyridin-1-ium-2-yl)phenyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | C[n+]1ccccc1-c1c(F)c(F)c(C2=c3ccc([nH]3)=C(c3c(F)c(F)c(-c4cccc[n+]4C)c(F)c3F)c3ccc([nH]3)C(c3c(F)c(F)c(-c4cccc[n+]4C)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(-c4cccc[n+]4C)c(F)c3F)c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C68H38F16N8/c1-89-25-9-5-13-37(89)45-53(69)61(77)49(62(78)54(45)70)41-29-17-19-31(85-29)42(50-63(79)55(71)46(56(72)64(50)80)38-14-6-10-26-90(38)2)33-21-23-35(87-33)44(52-67(83)59(75)48(60(76)68(52)84)40-16-8-12-28-92(40)4)36-24-22-34(88-36)43(32-20-18-30(41)86-32)51-65(81)57(73)47(58(74)66(51)82)39-15-7-11-27-91(39)3/h5-28H,1-4H3,(H2,85,86,87,88)/q+2/p+2 |
| InChIKey | DDJJXAJRJWZZRO-UHFFFAOYSA-P |
| XLogP | 10.49 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1273.09 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|