C17H14F3N3O5 — CID 90976855
N-hydroxy-5-[[5-methyl-5-[4-(trifluoromethoxy)phenyl]-2H-1,2-oxazol-3-yl]oxy]pyridine-2-carboxamide (PubChem CID 90976855) has the molecular formula C17H14F3N3O5 and a molecular weight of 397.31 g/mol. Its IUPAC name is N-hydroxy-5-[[5-methyl-5-[4-(trifluoromethoxy)phenyl]-2H-1,2-oxazol-3-yl]oxy]pyridine-2-carboxamide.
| Compound Name | N-hydroxy-5-[[5-methyl-5-[4-(trifluoromethoxy)phenyl]-2H-1,2-oxazol-3-yl]oxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90976855 |
| Molecular Formula | C17H14F3N3O5 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-hydroxy-5-[[5-methyl-5-[4-(trifluoromethoxy)phenyl]-2H-1,2-oxazol-3-yl]oxy]pyridine-2-carboxamide |
| SMILES | CC1(c2ccc(OC(F)(F)F)cc2)C=C(Oc2ccc(C(=O)NO)nc2)NO1 |
| InChI | InChI=1S/C17H14F3N3O5/c1-16(10-2-4-11(5-3-10)27-17(18,19)20)8-14(23-28-16)26-12-6-7-13(21-9-12)15(24)22-25/h2-9,23,25H,1H3,(H,22,24) |
| InChIKey | WITARHICHINIHA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|