C12H19N5 — CID 90976922
2-N-[3-(dimethylamino)propyl]pyrazolo[1,5-a]pyridine-2,3-diamine (PubChem CID 90976922) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]pyrazolo[1,5-a]pyridine-2,3-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]pyrazolo[1,5-a]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 90976922 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]pyrazolo[1,5-a]pyridine-2,3-diamine |
| SMILES | CN(C)CCCNc1nn2ccccc2c1N |
| InChI | InChI=1S/C12H19N5/c1-16(2)8-5-7-14-12-11(13)10-6-3-4-9-17(10)15-12/h3-4,6,9H,5,7-8,13H2,1-2H3,(H,14,15) |
| InChIKey | BTUPZBXCRGXVGS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|