About (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate
(2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate (PubChem CID 90977095) has the molecular formula C21H25BrN2O2
and a molecular weight of 417.35 g/mol. Its IUPAC name is (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate |
| PubChem CID | 90977095 |
| Molecular Formula | C21H25BrN2O2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)On1c(Br)c(C2CCCCC2)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C21H25BrN2O2/c1-21(2,3)12-18(25)26-24-17-11-14(13-23)9-10-16(17)19(20(24)22)15-7-5-4-6-8-15/h9-11,15H,4-8,12H2,1-3H3 |
| InChIKey | HPYBHGMOWRNLSO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate?
The IUPAC name of (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate (CID 90977095) is (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate.
What is the SMILES notation for (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate?
The canonical SMILES for (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate is CC(C)(C)CC(=O)On1c(Br)c(C2CCCCC2)c2ccc(C#N)cc21.
What is the InChIKey of (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate?
The InChIKey is HPYBHGMOWRNLSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25BrN2O2/c1-21(2,3)12-18(25)26-24-17-11-14(13-23)9-10-16(17)19(20(24)22)15-7-5-4-6-8-15/h9-11,15H,4-8,12H2,1-3H3.
What are the key properties of (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate?
(2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate has a molecular weight of 417.35 g/mol, XLogP of 5.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-6-cyano-3-cyclohexylindol-1-yl) 3,3-dimethylbutanoate is sourced from PubChem (CID 90977095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).