About cyclooct-5-ene-1,2-dicarbonitrile
cyclooct-5-ene-1,2-dicarbonitrile (PubChem CID 90978277) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is cyclooct-5-ene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | cyclooct-5-ene-1,2-dicarbonitrile |
| PubChem CID | 90978277 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | cyclooct-5-ene-1,2-dicarbonitrile |
| SMILES | N#CC1CCC=CCCC1C#N |
| InChI | InChI=1S/C10H12N2/c11-7-9-5-3-1-2-4-6-10(9)8-12/h1-2,9-10H,3-6H2 |
| InChIKey | UEVZZEIJMGLPAB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclooct-5-ene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooct-5-ene-1,2-dicarbonitrile?
The IUPAC name of cyclooct-5-ene-1,2-dicarbonitrile (CID 90978277) is cyclooct-5-ene-1,2-dicarbonitrile.
What is the SMILES notation for cyclooct-5-ene-1,2-dicarbonitrile?
The canonical SMILES for cyclooct-5-ene-1,2-dicarbonitrile is N#CC1CCC=CCCC1C#N.
What is the InChIKey of cyclooct-5-ene-1,2-dicarbonitrile?
The InChIKey is UEVZZEIJMGLPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c11-7-9-5-3-1-2-4-6-10(9)8-12/h1-2,9-10H,3-6H2.
What are the key properties of cyclooct-5-ene-1,2-dicarbonitrile?
cyclooct-5-ene-1,2-dicarbonitrile has a molecular weight of 160.22 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooct-5-ene-1,2-dicarbonitrile is sourced from PubChem (CID 90978277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).