C11H16O6S — CID 90978357
4-(2-butylsulfanyl-1-carboxyethoxy)-4-oxobut-2-enoic acid (PubChem CID 90978357) has the molecular formula C11H16O6S and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-(2-butylsulfanyl-1-carboxyethoxy)-4-oxobut-2-enoic acid.
| Compound Name | 4-(2-butylsulfanyl-1-carboxyethoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 90978357 |
| Molecular Formula | C11H16O6S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(2-butylsulfanyl-1-carboxyethoxy)-4-oxobut-2-enoic acid |
| SMILES | CCCCSCC(OC(=O)C=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16O6S/c1-2-3-6-18-7-8(11(15)16)17-10(14)5-4-9(12)13/h4-5,8H,2-3,6-7H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | HJYAVBOPOLUKJS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|