C11H17F3N4 — CID 90978657
8-ethyl-5,6,7-trimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 90978657) has the molecular formula C11H17F3N4 and a molecular weight of 262.28 g/mol. Its IUPAC name is 8-ethyl-5,6,7-trimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-ethyl-5,6,7-trimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 90978657 |
| Molecular Formula | C11H17F3N4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 8-ethyl-5,6,7-trimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCC1c2nnc(C(F)(F)F)n2C(C)C(C)N1C |
| InChI | InChI=1S/C11H17F3N4/c1-5-8-9-15-16-10(11(12,13)14)18(9)7(3)6(2)17(8)4/h6-8H,5H2,1-4H3 |
| InChIKey | CEZCQPFONQMNPI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |