About 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde
3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde (PubChem CID 90979411) has the molecular formula C12H22NOS+
and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde |
| PubChem CID | 90979411 |
| Molecular Formula | C12H22NOS+ |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde |
| SMILES | CCCCCCC[N+]1=C(C=O)SCC1C |
| InChI | InChI=1S/C12H22NOS/c1-3-4-5-6-7-8-13-11(2)10-15-12(13)9-14/h9,11H,3-8,10H2,1-2H3/q+1 |
| InChIKey | UONXYBGJHXJZLW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde?
The IUPAC name of 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde (CID 90979411) is 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde.
What is the SMILES notation for 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde?
The canonical SMILES for 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde is CCCCCCC[N+]1=C(C=O)SCC1C.
What is the InChIKey of 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde?
The InChIKey is UONXYBGJHXJZLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22NOS/c1-3-4-5-6-7-8-13-11(2)10-15-12(13)9-14/h9,11H,3-8,10H2,1-2H3/q+1.
What are the key properties of 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde?
3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde has a molecular weight of 228.38 g/mol, XLogP of 2.70, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-carbaldehyde is sourced from PubChem (CID 90979411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).