C28H34N10O10S2 — CID 90979545
4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-[4-[bis(2-hydroxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]ethenyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 90979545) has the molecular formula C28H34N10O10S2 and a molecular weight of 734.77 g/mol. Its IUPAC name is 4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-[4-[bis(2-hydroxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]ethenyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-[4-[bis(2-hydroxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]ethenyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 90979545 |
| Molecular Formula | C28H34N10O10S2 |
| Molecular Weight | 734.77 g/mol |
| Exact Mass | 734.19 |
| IUPAC Name | 4-[[4-[bis(2-hydroxyethyl)amino]-6-[2-[4-[bis(2-hydroxyethyl)amino]-6-(4-sulfoanilino)-1,3,5-triazin-2-yl]ethenyl]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Nc2nc(C=Cc3nc(Nc4ccc(S(=O)(=O)O)cc4)nc(N(CCO)CCO)n3)nc(N(CCO)CCO)n2)cc1 |
| InChI | InChI=1S/C28H34N10O10S2/c39-15-11-37(12-16-40)27-33-23(31-25(35-27)29-19-1-5-21(6-2-19)49(43,44)45)9-10-24-32-26(36-28(34-24)38(13-17-41)14-18-42)30-20-3-7-22(8-4-20)50(46,47)48/h1-10,39-42H,11-18H2,(H,43,44,45)(H,46,47,48)(H,29,31,33,35)(H,30,32,34,36) |
| InChIKey | XLXQPCMTCRZTNY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 297.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.77 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|