C12H14N2O2S2 — CID 90979785
prop-2-enyl (2R)-2-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 90979785) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | prop-2-enyl (2R)-2-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 90979785 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | prop-2-enyl (2R)-2-methyl-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(c2csc(=S)[nH]2)=C[C@H]1C |
| InChI | InChI=1S/C12H14N2O2S2/c1-3-4-16-12(15)14-6-9(5-8(14)2)10-7-18-11(17)13-10/h3,5,7-8H,1,4,6H2,2H3,(H,13,17)/t8-/m1/s1 |
| InChIKey | OTUQRTZPGZNSAC-MRVPVSSYSA-N |
| XLogP | 3.22 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|