C18H22N2O2 — CID 90979788
2-acetyl-5,6-dimethyl-N-phenylpyridine-3-carboxamide;ethane (PubChem CID 90979788) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-acetyl-5,6-dimethyl-N-phenylpyridine-3-carboxamide;ethane.
| Compound Name | 2-acetyl-5,6-dimethyl-N-phenylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 90979788 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-acetyl-5,6-dimethyl-N-phenylpyridine-3-carboxamide;ethane |
| SMILES | CC.CC(=O)c1nc(C)c(C)cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H16N2O2.C2H6/c1-10-9-14(15(12(3)19)17-11(10)2)16(20)18-13-7-5-4-6-8-13;1-2/h4-9H,1-3H3,(H,18,20);1-2H3 |
| InChIKey | IHGXOFNURAZUJG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |