C19H28N6O7 — CID 90980015
N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-(formamidomethyl)-3-(3-methylbutanoylamino)pentanediamide (PubChem CID 90980015) has the molecular formula C19H28N6O7 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-(formamidomethyl)-3-(3-methylbutanoylamino)pentanediamide.
| Compound Name | N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-(formamidomethyl)-3-(3-methylbutanoylamino)pentanediamide |
|---|---|
| PubChem CID | 90980015 |
| Molecular Formula | C19H28N6O7 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-(formamidomethyl)-3-(3-methylbutanoylamino)pentanediamide |
| SMILES | CC(C)CC(=O)NC(CC(=O)NCNC=O)CC(=O)NCNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H28N6O7/c1-12(2)5-16(29)24-13(6-14(27)21-9-20-11-26)7-15(28)22-10-23-17(30)8-25-18(31)3-4-19(25)32/h3-4,11-13H,5-10H2,1-2H3,(H,20,26)(H,21,27)(H,22,28)(H,23,30)(H,24,29) |
| InChIKey | BYODCCBKYCSAPR-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 182.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|