C24H30O3 — CID 90980264
1-[(1'R,8'S,13'S,14'S,17'S)-1'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone (PubChem CID 90980264) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-[(1'R,8'S,13'S,14'S,17'S)-1'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone.
| Compound Name | 1-[(1'R,8'S,13'S,14'S,17'S)-1'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone |
|---|---|
| PubChem CID | 90980264 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 1-[(1'R,8'S,13'S,14'S,17'S)-1'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone |
| SMILES | C#C[C@H]1CC2(CC3=C1C1=CC[C@]4(C)[C@@H](C(C)=O)CC[C@H]4[C@@H]1CC3)OCCO2 |
| InChI | InChI=1S/C24H30O3/c1-4-16-13-24(26-11-12-27-24)14-17-5-6-18-19(22(16)17)9-10-23(3)20(15(2)25)7-8-21(18)23/h1,9,16,18,20-21H,5-8,10-14H2,2-3H3/t16-,18+,20+,21-,23+/m0/s1 |
| InChIKey | JUNBUPKEZKMHRB-LUTKVVSBSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|