C16H27NO3 — CID 90980292
2-(4-hydroxy-3-methylphenoxy)-N-(2-methylpropyl)acetamide;propane (PubChem CID 90980292) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methylphenoxy)-N-(2-methylpropyl)acetamide;propane.
| Compound Name | 2-(4-hydroxy-3-methylphenoxy)-N-(2-methylpropyl)acetamide;propane |
|---|---|
| PubChem CID | 90980292 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-(4-hydroxy-3-methylphenoxy)-N-(2-methylpropyl)acetamide;propane |
| SMILES | CCC.Cc1cc(OCC(=O)NCC(C)C)ccc1O |
| InChI | InChI=1S/C13H19NO3.C3H8/c1-9(2)7-14-13(16)8-17-11-4-5-12(15)10(3)6-11;1-3-2/h4-6,9,15H,7-8H2,1-3H3,(H,14,16);3H2,1-2H3 |
| InChIKey | CCYFHUUPAYORCY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |