About [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate
[3-(2-methylpropyl)phenyl] 5-acetamidopentanoate (PubChem CID 90980403) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate.
Molecular Properties
| Compound Name | [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate |
| PubChem CID | 90980403 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate |
| SMILES | CC(=O)NCCCCC(=O)Oc1cccc(CC(C)C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-13(2)11-15-7-6-8-16(12-15)21-17(20)9-4-5-10-18-14(3)19/h6-8,12-13H,4-5,9-11H2,1-3H3,(H,18,19) |
| InChIKey | WOUUJZIYYBETFO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate?
The IUPAC name of [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate (CID 90980403) is [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate.
What is the SMILES notation for [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate?
The canonical SMILES for [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate is CC(=O)NCCCCC(=O)Oc1cccc(CC(C)C)c1.
What is the InChIKey of [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate?
The InChIKey is WOUUJZIYYBETFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-13(2)11-15-7-6-8-16(12-15)21-17(20)9-4-5-10-18-14(3)19/h6-8,12-13H,4-5,9-11H2,1-3H3,(H,18,19).
What are the key properties of [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate?
[3-(2-methylpropyl)phenyl] 5-acetamidopentanoate has a molecular weight of 291.39 g/mol, XLogP of 3.10, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methylpropyl)phenyl] 5-acetamidopentanoate is sourced from PubChem (CID 90980403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).