About 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one
2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 90981098) has the molecular formula C19H17N3O
and a molecular weight of 303.37 g/mol. Its IUPAC name is 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 90981098 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | CCc1[nH]nc2cc(C3CC34C(=O)Nc3ccccc34)ccc12 |
| InChI | InChI=1S/C19H17N3O/c1-2-15-12-8-7-11(9-17(12)22-21-15)14-10-19(14)13-5-3-4-6-16(13)20-18(19)23/h3-9,14H,2,10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | OKDAQBCEUPXZDB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one (CID 90981098) is 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one is CCc1[nH]nc2cc(C3CC34C(=O)Nc3ccccc34)ccc12.
What is the InChIKey of 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is OKDAQBCEUPXZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O/c1-2-15-12-8-7-11(9-17(12)22-21-15)14-10-19(14)13-5-3-4-6-16(13)20-18(19)23/h3-9,14H,2,10H2,1H3,(H,20,23)(H,21,22).
What are the key properties of 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 303.37 g/mol, XLogP of 3.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-(3-ethyl-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 90981098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).