About 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene
1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene (PubChem CID 90981281) has the molecular formula C21H28F4O
and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene |
| PubChem CID | 90981281 |
| Molecular Formula | C21H28F4O |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene |
| SMILES | CC1CCC(C2CC=C(OCF)CC2)CC1.Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H23FO.C7H5F3/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)16-10-15;1-4-2-3-5(8)7(10)6(4)9/h8,11-13H,2-7,9-10H2,1H3;2-3H,1H3 |
| InChIKey | LMSYVJZYXOMPCW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene?
The IUPAC name of 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene (CID 90981281) is 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene.
What is the SMILES notation for 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene?
The canonical SMILES for 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene is CC1CCC(C2CC=C(OCF)CC2)CC1.Cc1ccc(F)c(F)c1F.
What is the InChIKey of 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene?
The InChIKey is LMSYVJZYXOMPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23FO.C7H5F3/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)16-10-15;1-4-2-3-5(8)7(10)6(4)9/h8,11-13H,2-7,9-10H2,1H3;2-3H,1H3.
What are the key properties of 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene?
1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene has a molecular weight of 372.45 g/mol, XLogP of 6.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(fluoromethoxy)-4-(4-methylcyclohexyl)cyclohexene;1,2,3-trifluoro-4-methylbenzene is sourced from PubChem (CID 90981281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).