C33H40F3NO5S2 — CID 90981337
N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 90981337) has the molecular formula C33H40F3NO5S2 and a molecular weight of 651.81 g/mol. Its IUPAC name is N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90981337 |
| Molecular Formula | C33H40F3NO5S2 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | N-[5-tert-butyl-4-(6,6-dicyclopentyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1cc(SC2C(=O)CC(C3CCCC3)(C3CCCC3)OC2=O)c(C(C)(C)C)cc1NS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H40F3NO5S2/c1-20-17-28(43-29-27(38)19-32(42-30(29)39,21-9-5-6-10-21)22-11-7-8-12-22)25(31(2,3)4)18-26(20)37-44(40,41)24-15-13-23(14-16-24)33(34,35)36/h13-18,21-22,29,37H,5-12,19H2,1-4H3 |
| InChIKey | GCOFKHKYLHUJBQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|