C19H18F2O5S — CID 90981528
5-(3,4-difluorophenyl)-6-hydroxy-4-(4-methylsulfonylphenyl)hex-4-enoic acid (PubChem CID 90981528) has the molecular formula C19H18F2O5S and a molecular weight of 396.41 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-6-hydroxy-4-(4-methylsulfonylphenyl)hex-4-enoic acid.
| Compound Name | 5-(3,4-difluorophenyl)-6-hydroxy-4-(4-methylsulfonylphenyl)hex-4-enoic acid |
|---|---|
| PubChem CID | 90981528 |
| Molecular Formula | C19H18F2O5S |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 5-(3,4-difluorophenyl)-6-hydroxy-4-(4-methylsulfonylphenyl)hex-4-enoic acid |
| SMILES | CS(=O)(=O)c1ccc(C(CCC(=O)O)=C(CO)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H18F2O5S/c1-27(25,26)14-5-2-12(3-6-14)15(7-9-19(23)24)16(11-22)13-4-8-17(20)18(21)10-13/h2-6,8,10,22H,7,9,11H2,1H3,(H,23,24) |
| InChIKey | UIUVDISJFJRJNQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|