About methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate
methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate (PubChem CID 90981894) has the molecular formula C13H14FNO3
and a molecular weight of 251.26 g/mol. Its IUPAC name is methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate.
Molecular Properties
| Compound Name | methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate |
| PubChem CID | 90981894 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate |
| SMILES | CCO[C@H]1CC(C(=O)OC)=Nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H14FNO3/c1-3-18-12-7-11(13(16)17-2)15-10-5-4-8(14)6-9(10)12/h4-6,12H,3,7H2,1-2H3/t12-/m0/s1 |
| InChIKey | CGPHVSKHSWSOOT-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate?
The IUPAC name of methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate (CID 90981894) is methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate.
What is the SMILES notation for methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate?
The canonical SMILES for methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate is CCO[C@H]1CC(C(=O)OC)=Nc2ccc(F)cc21.
What is the InChIKey of methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate?
The InChIKey is CGPHVSKHSWSOOT-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H14FNO3/c1-3-18-12-7-11(13(16)17-2)15-10-5-4-8(14)6-9(10)12/h4-6,12H,3,7H2,1-2H3/t12-/m0/s1.
What are the key properties of methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate?
methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate has a molecular weight of 251.26 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S)-4-ethoxy-6-fluoro-3,4-dihydroquinoline-2-carboxylate is sourced from PubChem (CID 90981894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).