C23H46O2 — CID 90981901
5-ethyl-2,7,8,10-tetramethyl-6-pent-3-en-2-yldodecane-1,5-diol (PubChem CID 90981901) has the molecular formula C23H46O2 and a molecular weight of 354.62 g/mol. Its IUPAC name is 5-ethyl-2,7,8,10-tetramethyl-6-pent-3-en-2-yldodecane-1,5-diol.
| Compound Name | 5-ethyl-2,7,8,10-tetramethyl-6-pent-3-en-2-yldodecane-1,5-diol |
|---|---|
| PubChem CID | 90981901 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | 5-ethyl-2,7,8,10-tetramethyl-6-pent-3-en-2-yldodecane-1,5-diol |
| SMILES | CC=CC(C)C(C(C)C(C)CC(C)CC)C(O)(CC)CCC(C)CO |
| InChI | InChI=1S/C23H46O2/c1-9-12-19(6)22(21(8)20(7)15-17(4)10-2)23(25,11-3)14-13-18(5)16-24/h9,12,17-22,24-25H,10-11,13-16H2,1-8H3 |
| InChIKey | GIHYUEQMKPZTIM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|