C14H19N3O3S — CID 9098192
(2S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-N-ethylpropanamide (PubChem CID 9098192) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-N-ethylpropanamide.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 9098192 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@H](C)NC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19N3O3S/c1-3-15-13(18)9(2)17-14(21)16-7-10-4-5-11-12(6-10)20-8-19-11/h4-6,9H,3,7-8H2,1-2H3,(H,15,18)(H2,16,17,21)/t9-/m0/s1 |
| InChIKey | OVGOJNNYLWETIH-VIFPVBQESA-N |
| XLogP | 0.90 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|