C18H20N4O5 — CID 90981981
4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethoxy]butanoic acid (PubChem CID 90981981) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethoxy]butanoic acid.
| Compound Name | 4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethoxy]butanoic acid |
|---|---|
| PubChem CID | 90981981 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethoxy]butanoic acid |
| SMILES | Cc1cc2nc3[nH]c(=O)n(CCOCCCC(=O)O)c(=O)c3nc2cc1C |
| InChI | InChI=1S/C18H20N4O5/c1-10-8-12-13(9-11(10)2)20-16-15(19-12)17(25)22(18(26)21-16)5-7-27-6-3-4-14(23)24/h8-9H,3-7H2,1-2H3,(H,23,24)(H,20,21,26) |
| InChIKey | WRYLLCHPXNHVPA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|