About 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane
1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane (PubChem CID 90982024) has the molecular formula C12H22ClO2P
and a molecular weight of 264.73 g/mol. Its IUPAC name is 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane.
Molecular Properties
| Compound Name | 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane |
| PubChem CID | 90982024 |
| Molecular Formula | C12H22ClO2P |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane |
| SMILES | CCCCC(=C=CCCl)P(OCC)OCC |
| InChI | InChI=1S/C12H22ClO2P/c1-4-7-9-12(10-8-11-13)16(14-5-2)15-6-3/h8H,4-7,9,11H2,1-3H3 |
| InChIKey | CWLAYDKVKFBXMJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane?
The IUPAC name of 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane (CID 90982024) is 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane.
What is the SMILES notation for 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane?
The canonical SMILES for 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane is CCCCC(=C=CCCl)P(OCC)OCC.
What is the InChIKey of 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane?
The InChIKey is CWLAYDKVKFBXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClO2P/c1-4-7-9-12(10-8-11-13)16(14-5-2)15-6-3/h8H,4-7,9,11H2,1-3H3.
What are the key properties of 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane?
1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane has a molecular weight of 264.73 g/mol, XLogP of 4.84, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroocta-2,3-dien-4-yl(diethoxy)phosphane is sourced from PubChem (CID 90982024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).